C23H29BrO3Si — CID 134877698
[(1R,2R)-2-(2-bromo-4-methoxyphenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134877698) has the molecular formula C23H29BrO3Si and a molecular weight of 461.47 g/mol. Its IUPAC name is [(1R,2R)-2-(2-bromo-4-methoxyphenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R)-2-(2-bromo-4-methoxyphenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134877698 |
| Molecular Formula | C23H29BrO3Si |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [(1R,2R)-2-(2-bromo-4-methoxyphenoxy)-1,2-dihydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(O[C@@H]2C=Cc3ccccc3[C@H]2O[Si](C)(C)C(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C23H29BrO3Si/c1-23(2,3)28(5,6)27-22-18-10-8-7-9-16(18)11-13-21(22)26-20-14-12-17(25-4)15-19(20)24/h7-15,21-22H,1-6H3/t21-,22-/m1/s1 |
| InChIKey | RBQLTNILOGVTJT-FGZHOGPDSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|