C40H48F2N2O3 — CID 134877834
(1R)-N,N-dibenzyl-3-(3,5-difluorophenyl)-1-[(3R,5S,6R)-6-(2,2-dimethylpropoxy)-5-methylmorpholin-3-yl]-1-phenylmethoxypropan-2-amine (PubChem CID 134877834) has the molecular formula C40H48F2N2O3 and a molecular weight of 642.83 g/mol. Its IUPAC name is (1R)-N,N-dibenzyl-3-(3,5-difluorophenyl)-1-[(3R,5S,6R)-6-(2,2-dimethylpropoxy)-5-methylmorpholin-3-yl]-1-phenylmethoxypropan-2-amine.
| Compound Name | (1R)-N,N-dibenzyl-3-(3,5-difluorophenyl)-1-[(3R,5S,6R)-6-(2,2-dimethylpropoxy)-5-methylmorpholin-3-yl]-1-phenylmethoxypropan-2-amine |
|---|---|
| PubChem CID | 134877834 |
| Molecular Formula | C40H48F2N2O3 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | (1R)-N,N-dibenzyl-3-(3,5-difluorophenyl)-1-[(3R,5S,6R)-6-(2,2-dimethylpropoxy)-5-methylmorpholin-3-yl]-1-phenylmethoxypropan-2-amine |
| SMILES | C[C@@H]1N[C@@H]([C@@H](OCc2ccccc2)C(Cc2cc(F)cc(F)c2)N(Cc2ccccc2)Cc2ccccc2)CO[C@H]1OCC(C)(C)C |
| InChI | InChI=1S/C40H48F2N2O3/c1-29-39(47-28-40(2,3)4)46-27-36(43-29)38(45-26-32-18-12-7-13-19-32)37(22-33-20-34(41)23-35(42)21-33)44(24-30-14-8-5-9-15-30)25-31-16-10-6-11-17-31/h5-21,23,29,36-39,43H,22,24-28H2,1-4H3/t29-,36+,37?,38+,39-/m0/s1 |
| InChIKey | NVEVXIDSXDJJOT-SDCSWBPWSA-N |
| XLogP | 7.93 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |