C30H57IO5Si2 — CID 134878040
triethyl-[[(4R,6R,8R,10S,13R)-4-(iodomethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane (PubChem CID 134878040) has the molecular formula C30H57IO5Si2 and a molecular weight of 680.86 g/mol. Its IUPAC name is triethyl-[[(4R,6R,8R,10S,13R)-4-(iodomethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane.
| Compound Name | triethyl-[[(4R,6R,8R,10S,13R)-4-(iodomethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
|---|---|
| PubChem CID | 134878040 |
| Molecular Formula | C30H57IO5Si2 |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | triethyl-[[(4R,6R,8R,10S,13R)-4-(iodomethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
| SMILES | C=CC(C[C@@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@]2(CC[C@@]3(CCC[C@H](CI)O3)O2)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H57IO5Si2/c1-9-25(34-37(10-2,11-3)12-4)23-26-18-20-28(8,36-38(13-5,14-6)15-7)30(33-26)22-21-29(35-30)19-16-17-27(24-31)32-29/h9,25-27H,1,10-24H2,2-8H3/t25?,26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | RYTALGAYNMVNHY-XAGZMVNWSA-N |
| XLogP | 9.12 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|