About (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane
(3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 134878056) has the molecular formula C15H26O2S2
and a molecular weight of 302.50 g/mol. Its IUPAC name is (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 134878056 |
| Molecular Formula | C15H26O2S2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C1CCC2(CC1)OC[C@H](CCCC1SCCCS1)O2 |
| InChI | InChI=1S/C15H26O2S2/c1-2-8-15(9-3-1)16-12-13(17-15)6-4-7-14-18-10-5-11-19-14/h13-14H,1-12H2/t13-/m0/s1 |
| InChIKey | BGCNYUVHOMETRP-ZDUSSCGKSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane?
The IUPAC name of (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane (CID 134878056) is (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane is C1CCC2(CC1)OC[C@H](CCCC1SCCCS1)O2.
What is the InChIKey of (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane?
The InChIKey is BGCNYUVHOMETRP-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H26O2S2/c1-2-8-15(9-3-1)16-12-13(17-15)6-4-7-14-18-10-5-11-19-14/h13-14H,1-12H2/t13-/m0/s1.
What are the key properties of (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane?
(3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane has a molecular weight of 302.50 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[3-(1,3-dithian-2-yl)propyl]-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 134878056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).