C11H20O3 — CID 134878060
(4R,5R)-2,2,4-trimethyl-5-[(1S)-1-[(2S,3R)-3-methyloxiran-2-yl]ethyl]-1,3-dioxolane (PubChem CID 134878060) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4R,5R)-2,2,4-trimethyl-5-[(1S)-1-[(2S,3R)-3-methyloxiran-2-yl]ethyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-2,2,4-trimethyl-5-[(1S)-1-[(2S,3R)-3-methyloxiran-2-yl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134878060 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (4R,5R)-2,2,4-trimethyl-5-[(1S)-1-[(2S,3R)-3-methyloxiran-2-yl]ethyl]-1,3-dioxolane |
| SMILES | C[C@H]([C@H]1OC(C)(C)O[C@@H]1C)[C@@H]1O[C@@H]1C |
| InChI | InChI=1S/C11H20O3/c1-6(9-7(2)12-9)10-8(3)13-11(4,5)14-10/h6-10H,1-5H3/t6-,7+,8+,9-,10+/m0/s1 |
| InChIKey | UQJCIQOGYUTMLB-LOLPMWEVSA-N |
| XLogP | 1.95 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|