C28H40O3Si — CID 134878144
tert-butyl-[[(3R,5S,11R)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-3-yl]methoxy]-diphenylsilane (PubChem CID 134878144) has the molecular formula C28H40O3Si and a molecular weight of 452.71 g/mol. Its IUPAC name is tert-butyl-[[(3R,5S,11R)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-3-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(3R,5S,11R)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-3-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134878144 |
| Molecular Formula | C28H40O3Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | tert-butyl-[[(3R,5S,11R)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-3-yl]methoxy]-diphenylsilane |
| SMILES | CC1CCCOC12OC[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@@H]2C |
| InChI | InChI=1S/C28H40O3Si/c1-22-13-12-18-29-28(22)23(2)19-24(20-30-28)21-31-32(27(3,4)5,25-14-8-6-9-15-25)26-16-10-7-11-17-26/h6-11,14-17,22-24H,12-13,18-21H2,1-5H3/t22?,23-,24+,28?/m0/s1 |
| InChIKey | LMAYAPOJOWGYDF-MSSGHMPVSA-N |
| XLogP | 5.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|