C29H44O4S2Si — CID 134878188
tert-butyl-[(2R,3S)-4-(1,3-dithian-2-yl)-3-(2-methoxyethoxymethoxy)-2-methylbutoxy]-diphenylsilane (PubChem CID 134878188) has the molecular formula C29H44O4S2Si and a molecular weight of 548.89 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-4-(1,3-dithian-2-yl)-3-(2-methoxyethoxymethoxy)-2-methylbutoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S)-4-(1,3-dithian-2-yl)-3-(2-methoxyethoxymethoxy)-2-methylbutoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134878188 |
| Molecular Formula | C29H44O4S2Si |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | tert-butyl-[(2R,3S)-4-(1,3-dithian-2-yl)-3-(2-methoxyethoxymethoxy)-2-methylbutoxy]-diphenylsilane |
| SMILES | COCCOCO[C@@H](CC1SCCCS1)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H44O4S2Si/c1-24(27(32-23-31-18-17-30-5)21-28-34-19-12-20-35-28)22-33-36(29(2,3)4,25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-11,13-16,24,27-28H,12,17-23H2,1-5H3/t24-,27+/m1/s1 |
| InChIKey | WOBGENGSUCKSQY-SQHAQQRYSA-N |
| XLogP | 5.79 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|