About dimethyl-bis[(2E)-penta-2,4-dienyl]silane
dimethyl-bis[(2E)-penta-2,4-dienyl]silane (PubChem CID 13487823) has the molecular formula C12H20Si
and a molecular weight of 192.38 g/mol. Its IUPAC name is dimethyl-bis[(2E)-penta-2,4-dienyl]silane.
Molecular Properties
| Compound Name | dimethyl-bis[(2E)-penta-2,4-dienyl]silane |
| PubChem CID | 13487823 |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | dimethyl-bis[(2E)-penta-2,4-dienyl]silane |
| SMILES | C=C/C=C/C[Si](C)(C)C/C=C/C=C |
| InChI | InChI=1S/C12H20Si/c1-5-7-9-11-13(3,4)12-10-8-6-2/h5-10H,1-2,11-12H2,3-4H3/b9-7+,10-8+ |
| InChIKey | QNEWWIPAEPXZJN-FIFLTTCUSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis[(2E)-penta-2,4-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis[(2E)-penta-2,4-dienyl]silane?
The IUPAC name of dimethyl-bis[(2E)-penta-2,4-dienyl]silane (CID 13487823) is dimethyl-bis[(2E)-penta-2,4-dienyl]silane.
What is the SMILES notation for dimethyl-bis[(2E)-penta-2,4-dienyl]silane?
The canonical SMILES for dimethyl-bis[(2E)-penta-2,4-dienyl]silane is C=C/C=C/C[Si](C)(C)C/C=C/C=C.
What is the InChIKey of dimethyl-bis[(2E)-penta-2,4-dienyl]silane?
The InChIKey is QNEWWIPAEPXZJN-FIFLTTCUSA-N. The full InChI is InChI=1S/C12H20Si/c1-5-7-9-11-13(3,4)12-10-8-6-2/h5-10H,1-2,11-12H2,3-4H3/b9-7+,10-8+.
What are the key properties of dimethyl-bis[(2E)-penta-2,4-dienyl]silane?
dimethyl-bis[(2E)-penta-2,4-dienyl]silane has a molecular weight of 192.38 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis[(2E)-penta-2,4-dienyl]silane is sourced from PubChem (CID 13487823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).