C16H23F5Sn — CID 134878233
dibutyl-(1,1,2,2,2-pentafluoroethyl)-phenylstannane (PubChem CID 134878233) has the molecular formula C16H23F5Sn and a molecular weight of 429.06 g/mol. Its IUPAC name is dibutyl-(1,1,2,2,2-pentafluoroethyl)-phenylstannane.
| Compound Name | dibutyl-(1,1,2,2,2-pentafluoroethyl)-phenylstannane |
|---|---|
| PubChem CID | 134878233 |
| Molecular Formula | C16H23F5Sn |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | dibutyl-(1,1,2,2,2-pentafluoroethyl)-phenylstannane |
| SMILES | CCCC[Sn](CCCC)(c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5.2C4H9.C2F5.Sn/c1-2-4-6-5-3-1;2*1-3-4-2;3-1(4)2(5,6)7;/h1-5H;2*1,3-4H2,2H3;; |
| InChIKey | KCGIXEWKVWVXPC-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|