C31H46O9S2Si — CID 134878246
2-[(1R,2S,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylsulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]ethyl methanesulfonate (PubChem CID 134878246) has the molecular formula C31H46O9S2Si and a molecular weight of 654.92 g/mol. Its IUPAC name is 2-[(1R,2S,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylsulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]ethyl methanesulfonate.
| Compound Name | 2-[(1R,2S,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylsulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 134878246 |
| Molecular Formula | C31H46O9S2Si |
| Molecular Weight | 654.92 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 2-[(1R,2S,3R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylsulfonyloxy-3-(oxan-2-yloxy)cyclopentyl]ethyl methanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1[C@@H](CCOS(C)(=O)=O)[C@H](OS(C)(=O)=O)C[C@H]1OC1CCCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H46O9S2Si/c1-31(2,3)43(24-14-8-6-9-15-24,25-16-10-7-11-17-25)38-23-27-26(19-21-37-41(4,32)33)29(40-42(5,34)35)22-28(27)39-30-18-12-13-20-36-30/h6-11,14-17,26-30H,12-13,18-23H2,1-5H3/t26-,27-,28-,29-,30?/m1/s1 |
| InChIKey | ZRYCCJQKDXWYFF-BBSOXUCDSA-N |
| XLogP | 3.82 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|