C41H70O4S2SiSn — CID 134878277
tert-butyl-[(2R,3S)-3-(2-methoxyethoxymethoxy)-2-methyl-4-(2-tributylstannyl-1,3-dithian-2-yl)butoxy]-diphenylsilane (PubChem CID 134878277) has the molecular formula C41H70O4S2SiSn and a molecular weight of 837.94 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-3-(2-methoxyethoxymethoxy)-2-methyl-4-(2-tributylstannyl-1,3-dithian-2-yl)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S)-3-(2-methoxyethoxymethoxy)-2-methyl-4-(2-tributylstannyl-1,3-dithian-2-yl)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134878277 |
| Molecular Formula | C41H70O4S2SiSn |
| Molecular Weight | 837.94 g/mol |
| Exact Mass | 838.35 |
| IUPAC Name | tert-butyl-[(2R,3S)-3-(2-methoxyethoxymethoxy)-2-methyl-4-(2-tributylstannyl-1,3-dithian-2-yl)butoxy]-diphenylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1(C[C@H](OCOCCOC)[C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C29H43O4S2Si.3C4H9.Sn/c1-24(27(32-23-31-18-17-30-5)21-28-34-19-12-20-35-28)22-33-36(29(2,3)4,25-13-8-6-9-14-25)26-15-10-7-11-16-26;3*1-3-4-2;/h6-11,13-16,24,27H,12,17-23H2,1-5H3;3*1,3-4H2,2H3;/t24-,27+;;;;/m1..../s1 |
| InChIKey | VJIUXBJUFQQYPQ-LSOLEGLJSA-N |
| XLogP | 10.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.94 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|