C29H33NO4 — CID 134878280
benzyl (4S,5R)-4-methyl-5-phenyl-2-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 134878280) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is benzyl (4S,5R)-4-methyl-5-phenyl-2-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S,5R)-4-methyl-5-phenyl-2-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134878280 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | benzyl (4S,5R)-4-methyl-5-phenyl-2-[(2S)-4-phenylmethoxybutan-2-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@@H](CCOCc1ccccc1)C1O[C@H](c2ccccc2)[C@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H33NO4/c1-22(18-19-32-20-24-12-6-3-7-13-24)28-30(29(31)33-21-25-14-8-4-9-15-25)23(2)27(34-28)26-16-10-5-11-17-26/h3-17,22-23,27-28H,18-21H2,1-2H3/t22-,23-,27-,28?/m0/s1 |
| InChIKey | SOKXKABQVOUIKT-IOFCWMCSSA-N |
| XLogP | 6.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|