C35H42O5S2 — CID 134878313
methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate (PubChem CID 134878313) has the molecular formula C35H42O5S2 and a molecular weight of 606.85 g/mol. Its IUPAC name is methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate.
| Compound Name | methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate |
|---|---|
| PubChem CID | 134878313 |
| Molecular Formula | C35H42O5S2 |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | methyl (1R,2R,6S,7R,9R,17R)-17-(acetyloxymethyl)-2,6-dimethyl-11,14-bis(phenylsulfanyl)-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-13-ene-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)[C@H]3CCC(Sc4ccccc4)=C4CC(Sc5ccccc5)O[C@H](C[C@H]21)[C@@]43COC(C)=O |
| InChI | InChI=1S/C35H42O5S2/c1-23(36)39-22-35-26-20-31(42-25-14-9-6-10-15-25)40-30(35)21-29-33(2,18-11-19-34(29,3)32(37)38-4)28(35)17-16-27(26)41-24-12-7-5-8-13-24/h5-10,12-15,28-31H,11,16-22H2,1-4H3/t28-,29-,30-,31?,33-,34+,35+/m1/s1 |
| InChIKey | RZSQEUZOVOJFRC-GSVMYECNSA-N |
| XLogP | 8.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |