C13H20O5 — CID 134878351
(1'R,3'S,4S,4'R,5'R,6R)-4,6-dimethylspiro[1,3-dioxane-2,2'-6-oxabicyclo[3.2.2]non-8-ene]-3',4'-diol (PubChem CID 134878351) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1'R,3'S,4S,4'R,5'R,6R)-4,6-dimethylspiro[1,3-dioxane-2,2'-6-oxabicyclo[3.2.2]non-8-ene]-3',4'-diol.
| Compound Name | (1'R,3'S,4S,4'R,5'R,6R)-4,6-dimethylspiro[1,3-dioxane-2,2'-6-oxabicyclo[3.2.2]non-8-ene]-3',4'-diol |
|---|---|
| PubChem CID | 134878351 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1'R,3'S,4S,4'R,5'R,6R)-4,6-dimethylspiro[1,3-dioxane-2,2'-6-oxabicyclo[3.2.2]non-8-ene]-3',4'-diol |
| SMILES | C[C@@H]1C[C@H](C)OC2(O1)[C@@H]1C=C[C@@H](OC1)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C13H20O5/c1-7-5-8(2)18-13(17-7)9-3-4-10(16-6-9)11(14)12(13)15/h3-4,7-12,14-15H,5-6H2,1-2H3/t7-,8+,9-,10-,11+,12+,13?/m1/s1 |
| InChIKey | NHAKYLVYKLUHBP-BPZKJEGPSA-N |
| XLogP | 0.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|