C25H32O5Si — CID 134878356
2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde (PubChem CID 134878356) has the molecular formula C25H32O5Si and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde.
| Compound Name | 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 134878356 |
| Molecular Formula | C25H32O5Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[(3aR,4S,5S,6aR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H]2OC(O)C[C@@H]2[C@@H]1CC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32O5Si/c1-25(2,3)31(18-10-6-4-7-11-18,19-12-8-5-9-13-19)28-17-22-20(14-15-26)21-16-23(27)30-24(21)29-22/h4-13,15,20-24,27H,14,16-17H2,1-3H3/t20-,21+,22+,23?,24+/m0/s1 |
| InChIKey | OBPPGIVHDPSZPT-XAWFNSNLSA-N |
| XLogP | 2.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|