C16H24O8S2 — CID 134878391
[(2R,3R,4R)-2,3,4-triacetyloxy-4-(1,3-dithian-2-yl)butyl] acetate (PubChem CID 134878391) has the molecular formula C16H24O8S2 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-triacetyloxy-4-(1,3-dithian-2-yl)butyl] acetate.
| Compound Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-(1,3-dithian-2-yl)butyl] acetate |
|---|---|
| PubChem CID | 134878391 |
| Molecular Formula | C16H24O8S2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-(1,3-dithian-2-yl)butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1SCCCS1 |
| InChI | InChI=1S/C16H24O8S2/c1-9(17)21-8-13(22-10(2)18)14(23-11(3)19)15(24-12(4)20)16-25-6-5-7-26-16/h13-16H,5-8H2,1-4H3/t13-,14-,15-/m1/s1 |
| InChIKey | UKONKGRNSXNWGD-RBSFLKMASA-N |
| XLogP | 1.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|