C26H33NO4 — CID 134878401
tert-butyl (4R)-4-phenyl-2-[(1R)-1-phenylmethoxypent-4-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 134878401) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is tert-butyl (4R)-4-phenyl-2-[(1R)-1-phenylmethoxypent-4-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-phenyl-2-[(1R)-1-phenylmethoxypent-4-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134878401 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl (4R)-4-phenyl-2-[(1R)-1-phenylmethoxypent-4-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCC[C@@H](OCc1ccccc1)C1OC[C@@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H33NO4/c1-5-6-17-23(29-18-20-13-9-7-10-14-20)24-27(25(28)31-26(2,3)4)22(19-30-24)21-15-11-8-12-16-21/h5,7-16,22-24H,1,6,17-19H2,2-4H3/t22-,23+,24?/m0/s1 |
| InChIKey | RCDYZOSKXMDIJD-XAGPSQNTSA-N |
| XLogP | 5.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|