C19H36O6 — CID 134878462
(4S,5S,6R,8R)-5-(methoxymethoxy)-6-[2-(methoxymethoxy)ethyl]-4,8-dimethylundeca-1,10-diene-3,9-diol (PubChem CID 134878462) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4S,5S,6R,8R)-5-(methoxymethoxy)-6-[2-(methoxymethoxy)ethyl]-4,8-dimethylundeca-1,10-diene-3,9-diol.
| Compound Name | (4S,5S,6R,8R)-5-(methoxymethoxy)-6-[2-(methoxymethoxy)ethyl]-4,8-dimethylundeca-1,10-diene-3,9-diol |
|---|---|
| PubChem CID | 134878462 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (4S,5S,6R,8R)-5-(methoxymethoxy)-6-[2-(methoxymethoxy)ethyl]-4,8-dimethylundeca-1,10-diene-3,9-diol |
| SMILES | C=CC(O)[C@H](C)C[C@H](CCOCOC)[C@H](OCOC)[C@@H](C)C(O)C=C |
| InChI | InChI=1S/C19H36O6/c1-7-17(20)14(3)11-16(9-10-24-12-22-5)19(25-13-23-6)15(4)18(21)8-2/h7-8,14-21H,1-2,9-13H2,3-6H3/t14-,15+,16+,17?,18?,19-/m1/s1 |
| InChIKey | BZECTSLYWPDEQW-VUVKHIICSA-N |
| XLogP | 2.36 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|