C16H24O5S — CID 134878521
(2R,3R,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-phenylsulfanyloxane (PubChem CID 134878521) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-phenylsulfanyloxane.
| Compound Name | (2R,3R,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 134878521 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-phenylsulfanyloxane |
| SMILES | COC[C@H]1O[C@H](Sc2ccccc2)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C16H24O5S/c1-17-10-12-13(18-2)14(19-3)15(20-4)16(21-12)22-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | AELOUDJCCKGPQN-IBEHDNSVSA-N |
| XLogP | 2.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |