C27H23Cl4NO9S — CID 134878524
[(2R,3S,4R,5R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 134878524) has the molecular formula C27H23Cl4NO9S and a molecular weight of 679.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134878524 |
| Molecular Formula | C27H23Cl4NO9S |
| Molecular Weight | 679.36 g/mol |
| Exact Mass | 676.98 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-6-(4-methylphenyl)sulfanyl-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Sc2ccc(C)cc2)[C@H](N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H23Cl4NO9S/c1-10-5-7-14(8-6-10)42-27-22(32-25(36)16-17(26(32)37)19(29)21(31)20(30)18(16)28)24(40-13(4)35)23(39-12(3)34)15(41-27)9-38-11(2)33/h5-8,15,22-24,27H,9H2,1-4H3/t15-,22-,23-,24-,27?/m1/s1 |
| InChIKey | GTLYYOYPGYGJJU-PUWDAECZSA-N |
| XLogP | 5.52 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|