About (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne
(Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne (PubChem CID 134878544) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne.
Molecular Properties
| Compound Name | (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne |
| PubChem CID | 134878544 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne |
| SMILES | CCOC(C#C/C=C\SCC)OCC |
| InChI | InChI=1S/C11H18O2S/c1-4-12-11(13-5-2)9-7-8-10-14-6-3/h8,10-11H,4-6H2,1-3H3/b10-8- |
| InChIKey | GBZFXBXHBZMTLD-NTMALXAHSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne?
The IUPAC name of (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne (CID 134878544) is (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne.
What is the SMILES notation for (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne?
The canonical SMILES for (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne is CCOC(C#C/C=C\SCC)OCC.
What is the InChIKey of (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne?
The InChIKey is GBZFXBXHBZMTLD-NTMALXAHSA-N. The full InChI is InChI=1S/C11H18O2S/c1-4-12-11(13-5-2)9-7-8-10-14-6-3/h8,10-11H,4-6H2,1-3H3/b10-8-.
What are the key properties of (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne?
(Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne has a molecular weight of 214.33 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5,5-diethoxy-1-ethylsulfanylpent-1-en-3-yne is sourced from PubChem (CID 134878544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).