C26H32BrNO12S — CID 134878634
methyl (3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-bromo-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 134878634) has the molecular formula C26H32BrNO12S and a molecular weight of 662.51 g/mol. Its IUPAC name is methyl (3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-bromo-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-bromo-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 134878634 |
| Molecular Formula | C26H32BrNO12S |
| Molecular Weight | 662.51 g/mol |
| Exact Mass | 661.08 |
| IUPAC Name | methyl (3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-bromo-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1(Br)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(C)=O)[C@@H](OC(C)=O)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C26H32BrNO12S/c1-13(29)28-20-22(21(38-16(4)32)19(37-15(3)31)12-36-14(2)30)40-26(27,25(34)35-6)24(23(20)39-17(5)33)41-18-10-8-7-9-11-18/h7-11,19-24H,12H2,1-6H3,(H,28,29)/t19-,20+,21-,22-,23-,24+,26?/m1/s1 |
| InChIKey | SKGZFJKRGRHOKA-ILXGHUQVSA-N |
| XLogP | 1.67 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|