C18H22O7 — CID 134878643
[(2R,3R,4S)-3,4-diacetyloxy-5-benzyloxolan-2-yl]methyl acetate (PubChem CID 134878643) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-benzyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-benzyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134878643 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-benzyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Cc2ccccc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O7/c1-11(19)22-10-16-18(24-13(3)21)17(23-12(2)20)15(25-16)9-14-7-5-4-6-8-14/h4-8,15-18H,9-10H2,1-3H3/t15?,16-,17+,18-/m1/s1 |
| InChIKey | KAPIUKOPYSEBKN-HQSKLWIPSA-N |
| XLogP | 1.42 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|