C29H48O10 — CID 134878673
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-prop-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134878673) has the molecular formula C29H48O10 and a molecular weight of 556.69 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-prop-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-prop-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134878673 |
| Molecular Formula | C29H48O10 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-prop-1-enoxy]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C/C=C/O[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H48O10/c1-14-15-34-21-20(39-25(33)29(11,12)13)19(38-24(32)28(8,9)10)18(37-23(31)27(5,6)7)17(36-21)16-35-22(30)26(2,3)4/h14-15,17-21H,16H2,1-13H3/b15-14+/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | VEVURLGQEFVVMD-AAPPHOKSSA-N |
| XLogP | 4.72 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|