C20H27NO4 — CID 134878707
N-(1-butyl-3,4,4-trimethoxycyclohexa-2,5-dien-1-yl)benzamide (PubChem CID 134878707) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(1-butyl-3,4,4-trimethoxycyclohexa-2,5-dien-1-yl)benzamide.
| Compound Name | N-(1-butyl-3,4,4-trimethoxycyclohexa-2,5-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 134878707 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-(1-butyl-3,4,4-trimethoxycyclohexa-2,5-dien-1-yl)benzamide |
| SMILES | CCCCC1(NC(=O)c2ccccc2)C=CC(OC)(OC)C(OC)=C1 |
| InChI | InChI=1S/C20H27NO4/c1-5-6-12-19(21-18(22)16-10-8-7-9-11-16)13-14-20(24-3,25-4)17(15-19)23-2/h7-11,13-15H,5-6,12H2,1-4H3,(H,21,22) |
| InChIKey | CKDUYZLXLRBUTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|