C31H48O6Si2 — CID 134878718
(3aS,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-ol (PubChem CID 134878718) has the molecular formula C31H48O6Si2 and a molecular weight of 572.89 g/mol. Its IUPAC name is (3aS,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (3aS,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 134878718 |
| Molecular Formula | C31H48O6Si2 |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | (3aS,6R,6aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@@]2(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H48O6Si2/c1-28(2,3)38(9,10)33-21-25-26-31(27(32)35-25,37-30(7,8)36-26)22-34-39(29(4,5)6,23-17-13-11-14-18-23)24-19-15-12-16-20-24/h11-20,25-27,32H,21-22H2,1-10H3/t25-,26+,27?,31+/m1/s1 |
| InChIKey | FZDNJIJOVDWGPO-AAQHIEISSA-N |
| XLogP | 5.19 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|