C42H41NO6 — CID 134878750
(5R,6R,7S,8R,9R)-3-phenyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]dec-2-ene (PubChem CID 134878750) has the molecular formula C42H41NO6 and a molecular weight of 655.79 g/mol. Its IUPAC name is (5R,6R,7S,8R,9R)-3-phenyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]dec-2-ene.
| Compound Name | (5R,6R,7S,8R,9R)-3-phenyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 134878750 |
| Molecular Formula | C42H41NO6 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | (5R,6R,7S,8R,9R)-3-phenyl-6,7,8-tris(phenylmethoxy)-9-(phenylmethoxymethyl)-1,10-dioxa-2-azaspiro[4.5]dec-2-ene |
| SMILES | c1ccc(COC[C@H]2O[C@@]3(CC(c4ccccc4)=NO3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C42H41NO6/c1-6-16-32(17-7-1)27-44-31-38-39(45-28-33-18-8-2-9-19-33)40(46-29-34-20-10-3-11-21-34)41(47-30-35-22-12-4-13-23-35)42(48-38)26-37(43-49-42)36-24-14-5-15-25-36/h1-25,38-41H,26-31H2/t38-,39-,40+,41-,42-/m1/s1 |
| InChIKey | QRTNCRZZSCETFJ-QBLDGPCBSA-N |
| XLogP | 7.88 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |