C26H50O5Si — CID 134878899
tert-butyl 2-[(4S,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-pentyl-6-prop-2-enyl-1,3-dioxepan-4-yl]acetate (PubChem CID 134878899) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is tert-butyl 2-[(4S,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-pentyl-6-prop-2-enyl-1,3-dioxepan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4S,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-pentyl-6-prop-2-enyl-1,3-dioxepan-4-yl]acetate |
|---|---|
| PubChem CID | 134878899 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | tert-butyl 2-[(4S,5S,6R,7S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-pentyl-6-prop-2-enyl-1,3-dioxepan-4-yl]acetate |
| SMILES | C=CC[C@@H]1[C@H](CCCCC)OCO[C@@](C)(CC(=O)OC(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O5Si/c1-12-14-15-17-21-20(16-13-2)23(31-32(10,11)25(6,7)8)26(9,29-19-28-21)18-22(27)30-24(3,4)5/h13,20-21,23H,2,12,14-19H2,1,3-11H3/t20-,21+,23+,26+/m1/s1 |
| InChIKey | PJJKGISTQMAGEE-ZRAZWPEBSA-N |
| XLogP | 7.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|