C21H40O5 — CID 134878902
(2R,8S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol (PubChem CID 134878902) has the molecular formula C21H40O5 and a molecular weight of 372.55 g/mol. Its IUPAC name is (2R,8S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol.
| Compound Name | (2R,8S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol |
|---|---|
| PubChem CID | 134878902 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | (2R,8S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol |
| SMILES | C[C@@H]1COC(C)(C)OC1[C@@H](C)CCC(O)CC[C@@H](C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H40O5/c1-14(18-13-24-20(4,5)25-18)8-10-17(22)11-9-15(2)19-16(3)12-23-21(6,7)26-19/h14-19,22H,8-13H2,1-7H3/t14-,15+,16-,17?,18+,19?/m1/s1 |
| InChIKey | QKMLNLKIGKLHRI-MTXJJLJNSA-N |
| XLogP | 4.12 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |