C14H13BrN2O4 — CID 134878930
(7-bromo-8-methyl-6,9-dioxo-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl) acetate (PubChem CID 134878930) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is (7-bromo-8-methyl-6,9-dioxo-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl) acetate.
| Compound Name | (7-bromo-8-methyl-6,9-dioxo-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl) acetate |
|---|---|
| PubChem CID | 134878930 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | (7-bromo-8-methyl-6,9-dioxo-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-4-yl) acetate |
| SMILES | CC(=O)OC1CCCn2c1nc1c2C(=O)C(C)=C(Br)C1=O |
| InChI | InChI=1S/C14H13BrN2O4/c1-6-9(15)13(20)10-11(12(6)19)17-5-3-4-8(14(17)16-10)21-7(2)18/h8H,3-5H2,1-2H3 |
| InChIKey | XBYADGQFZSXHLL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|