C32H62O11Si — CID 134878962
methyl 2-[(4R,6R)-6-[(2S,4S,6S,8R)-9-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,4,6,8-tetrahydroxynonyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 134878962) has the molecular formula C32H62O11Si and a molecular weight of 650.92 g/mol. Its IUPAC name is methyl 2-[(4R,6R)-6-[(2S,4S,6S,8R)-9-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,4,6,8-tetrahydroxynonyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,6R)-6-[(2S,4S,6S,8R)-9-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,4,6,8-tetrahydroxynonyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 134878962 |
| Molecular Formula | C32H62O11Si |
| Molecular Weight | 650.92 g/mol |
| Exact Mass | 650.41 |
| IUPAC Name | methyl 2-[(4R,6R)-6-[(2S,4S,6S,8R)-9-[(4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2,4,6,8-tetrahydroxynonyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](C[C@@H](O)C[C@@H](O)C[C@H](O)C[C@@H](O)C[C@@H]2C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C32H62O11Si/c1-30(2,3)44(9,10)39-12-11-25-18-26(41-31(4,5)40-25)16-23(35)14-21(33)13-22(34)15-24(36)17-27-19-28(20-29(37)38-8)43-32(6,7)42-27/h21-28,33-36H,11-20H2,1-10H3/t21-,22-,23+,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | PUODAZJVAHDVRS-DNUAKRKWSA-N |
| XLogP | 4.18 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.92 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|