C17H21NO4 — CID 134878969
N-(3,4,4-trimethoxy-1-methylcyclohexa-2,5-dien-1-yl)benzamide (PubChem CID 134878969) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(3,4,4-trimethoxy-1-methylcyclohexa-2,5-dien-1-yl)benzamide.
| Compound Name | N-(3,4,4-trimethoxy-1-methylcyclohexa-2,5-dien-1-yl)benzamide |
|---|---|
| PubChem CID | 134878969 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-(3,4,4-trimethoxy-1-methylcyclohexa-2,5-dien-1-yl)benzamide |
| SMILES | COC1=CC(C)(NC(=O)c2ccccc2)C=CC1(OC)OC |
| InChI | InChI=1S/C17H21NO4/c1-16(18-15(19)13-8-6-5-7-9-13)10-11-17(21-3,22-4)14(12-16)20-2/h5-12H,1-4H3,(H,18,19) |
| InChIKey | YHVVNJYEINPWQI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|