C22H31NO3 — CID 134879135
tert-butyl N-benzyl-N-[(3S)-3-(1-oxobutan-2-yl)hex-5-ynyl]carbamate (PubChem CID 134879135) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(3S)-3-(1-oxobutan-2-yl)hex-5-ynyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(3S)-3-(1-oxobutan-2-yl)hex-5-ynyl]carbamate |
|---|---|
| PubChem CID | 134879135 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | tert-butyl N-benzyl-N-[(3S)-3-(1-oxobutan-2-yl)hex-5-ynyl]carbamate |
| SMILES | C#CC[C@@H](CCN(Cc1ccccc1)C(=O)OC(C)(C)C)C(C=O)CC |
| InChI | InChI=1S/C22H31NO3/c1-6-11-20(19(7-2)17-24)14-15-23(21(25)26-22(3,4)5)16-18-12-9-8-10-13-18/h1,8-10,12-13,17,19-20H,7,11,14-16H2,2-5H3/t19?,20-/m0/s1 |
| InChIKey | JGQZIENXUUNYIO-ANYOKISRSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|