C20H32O5S2 — CID 134879137
(2S,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-bis(ethylsulfanyl)-2-phenylmethoxybutane-1,3-diol (PubChem CID 134879137) has the molecular formula C20H32O5S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is (2S,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-bis(ethylsulfanyl)-2-phenylmethoxybutane-1,3-diol.
| Compound Name | (2S,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-bis(ethylsulfanyl)-2-phenylmethoxybutane-1,3-diol |
|---|---|
| PubChem CID | 134879137 |
| Molecular Formula | C20H32O5S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2S,3R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-bis(ethylsulfanyl)-2-phenylmethoxybutane-1,3-diol |
| SMILES | CCSC(SCC)[C@H](O)[C@@H](OCc1ccccc1)C(O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H32O5S2/c1-5-26-19(27-6-2)17(22)18(23-12-14-10-8-7-9-11-14)16(21)15-13-24-20(3,4)25-15/h7-11,15-19,21-22H,5-6,12-13H2,1-4H3/t15-,16?,17+,18-/m0/s1 |
| InChIKey | IRGUFMMWXJAZLT-WOPUZOFWSA-N |
| XLogP | 3.28 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|