C12H18F3NO6 — CID 134879216
N-[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoro-N-hydroxyacetamide (PubChem CID 134879216) has the molecular formula C12H18F3NO6 and a molecular weight of 329.27 g/mol. Its IUPAC name is N-[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoro-N-hydroxyacetamide.
| Compound Name | N-[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoro-N-hydroxyacetamide |
|---|---|
| PubChem CID | 134879216 |
| Molecular Formula | C12H18F3NO6 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[(3aR,4S,6R,7R,7aS)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoro-N-hydroxyacetamide |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N(O)C(=O)C(F)(F)F)[C@@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18F3NO6/c1-5-6(16(18)10(17)12(13,14)15)7-8(9(19-4)20-5)22-11(2,3)21-7/h5-9,18H,1-4H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | XOSAVNHBDGZOFQ-ZEBDFXRSSA-N |
| XLogP | 1.05 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|