C15H26O2 — CID 134879223
(4E,8R)-8-(1-methoxy-2-methylpropan-2-yl)-5-methylcyclonon-4-en-1-one (PubChem CID 134879223) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (4E,8R)-8-(1-methoxy-2-methylpropan-2-yl)-5-methylcyclonon-4-en-1-one.
| Compound Name | (4E,8R)-8-(1-methoxy-2-methylpropan-2-yl)-5-methylcyclonon-4-en-1-one |
|---|---|
| PubChem CID | 134879223 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (4E,8R)-8-(1-methoxy-2-methylpropan-2-yl)-5-methylcyclonon-4-en-1-one |
| SMILES | COCC(C)(C)[C@@H]1CC/C(C)=C/CCC(=O)C1 |
| InChI | InChI=1S/C15H26O2/c1-12-6-5-7-14(16)10-13(9-8-12)15(2,3)11-17-4/h6,13H,5,7-11H2,1-4H3/b12-6+/t13-/m1/s1 |
| InChIKey | AWZZTKVTVRHLIF-XEVNVYFWSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|