C20H39IO2Si — CID 134879243
tert-butyl-[(1S,2R)-1-[(1E)-2,6-dimethylhepta-1,5-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane (PubChem CID 134879243) has the molecular formula C20H39IO2Si and a molecular weight of 466.52 g/mol. Its IUPAC name is tert-butyl-[(1S,2R)-1-[(1E)-2,6-dimethylhepta-1,5-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2R)-1-[(1E)-2,6-dimethylhepta-1,5-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134879243 |
| Molecular Formula | C20H39IO2Si |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | tert-butyl-[(1S,2R)-1-[(1E)-2,6-dimethylhepta-1,5-dienoxy]-2-iodo-2-methylbutoxy]-dimethylsilane |
| SMILES | CC[C@@](C)(I)[C@@H](O/C=C(\C)CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H39IO2Si/c1-11-20(8,21)18(23-24(9,10)19(5,6)7)22-15-17(4)14-12-13-16(2)3/h13,15,18H,11-12,14H2,1-10H3/b17-15+/t18-,20+/m0/s1 |
| InChIKey | SMZRLBJDAMUPGT-OGMVEXJUSA-N |
| XLogP | 7.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|