C13H24OSi — CID 134879384
(2E,6E)-2,4,4-trimethyl-7-trimethylsilylhepta-2,6-dienal (PubChem CID 134879384) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is (2E,6E)-2,4,4-trimethyl-7-trimethylsilylhepta-2,6-dienal.
| Compound Name | (2E,6E)-2,4,4-trimethyl-7-trimethylsilylhepta-2,6-dienal |
|---|---|
| PubChem CID | 134879384 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (2E,6E)-2,4,4-trimethyl-7-trimethylsilylhepta-2,6-dienal |
| SMILES | C/C(C=O)=C\C(C)(C)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-12(11-14)10-13(2,3)8-7-9-15(4,5)6/h7,9-11H,8H2,1-6H3/b9-7+,12-10+ |
| InChIKey | QOKQDBDLDPEAMJ-LKJUMTHSSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|