C14H11F15O — CID 134879422
1-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one (PubChem CID 134879422) has the molecular formula C14H11F15O and a molecular weight of 480.21 g/mol. Its IUPAC name is 1-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one.
| Compound Name | 1-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one |
|---|---|
| PubChem CID | 134879422 |
| Molecular Formula | C14H11F15O |
| Molecular Weight | 480.21 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | 1-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one |
| SMILES | O=C(C1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F15O/c15-8(16,7(30)6-4-2-1-3-5-6)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h6H,1-5H2 |
| InChIKey | CREUGAHHCPBRNS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.21 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|