C22H40O2Si — CID 134879477
(1S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one (PubChem CID 134879477) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is (1S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one.
| Compound Name | (1S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one |
|---|---|
| PubChem CID | 134879477 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (1S,5S,6R,8S,9S)-6-[tert-butyl(dimethyl)silyl]oxy-5,8-dimethyl-9-propan-2-yltricyclo[6.3.0.01,5]undecan-4-one |
| SMILES | CC(C)[C@@H]1CC[C@@]23CCC(=O)[C@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]13C |
| InChI | InChI=1S/C22H40O2Si/c1-15(2)16-10-12-22-13-11-17(23)21(22,7)18(14-20(16,22)6)24-25(8,9)19(3,4)5/h15-16,18H,10-14H2,1-9H3/t16-,18+,20-,21+,22-/m0/s1 |
| InChIKey | QLTNNTVORCWDHG-KRIDKZTMSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|