C27H53NO3Si2 — CID 134879478
1-[(4R,5R)-5-[(2S,3S,4S,5E,7E)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-8-trimethylsilylocta-5,7-dien-2-yl]-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 134879478) has the molecular formula C27H53NO3Si2 and a molecular weight of 495.90 g/mol. Its IUPAC name is 1-[(4R,5R)-5-[(2S,3S,4S,5E,7E)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-8-trimethylsilylocta-5,7-dien-2-yl]-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 1-[(4R,5R)-5-[(2S,3S,4S,5E,7E)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-8-trimethylsilylocta-5,7-dien-2-yl]-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 134879478 |
| Molecular Formula | C27H53NO3Si2 |
| Molecular Weight | 495.90 g/mol |
| Exact Mass | 495.36 |
| IUPAC Name | 1-[(4R,5R)-5-[(2S,3S,4S,5E,7E)-3-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyl-8-trimethylsilylocta-5,7-dien-2-yl]-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CC(=O)N1[C@H](C)[C@@H]([C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C/C(C)=C/[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C27H53NO3Si2/c1-19(18-32(11,12)13)16-17-20(2)24(31-33(14,15)26(6,7)8)21(3)25-22(4)28(23(5)29)27(9,10)30-25/h16-18,20-22,24-25H,1-15H3/b17-16+,19-18+/t20-,21+,22+,24-,25+/m0/s1 |
| InChIKey | POYRCYNVKRUQOR-SWSCKLLUSA-N |
| XLogP | 7.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.90 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|