C18H36O3Si2 — CID 134879499
(3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 134879499) has the molecular formula C18H36O3Si2 and a molecular weight of 356.66 g/mol. Its IUPAC name is (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134879499 |
| Molecular Formula | C18H36O3Si2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-(trimethylsilyloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2CC(=O)C[C@@H]2[C@H]1CO[Si](C)(C)C |
| InChI | InChI=1S/C18H36O3Si2/c1-18(2,3)23(7,8)21-17-10-13-9-14(19)11-15(13)16(17)12-20-22(4,5)6/h13,15-17H,9-12H2,1-8H3/t13-,15-,16+,17+/m0/s1 |
| InChIKey | HTVJLZDKRKRCHP-QMCVQRASSA-N |
| XLogP | 4.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|