C17H23NO5S — CID 134879516
diethyl 2-[(E)-3-[(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate (PubChem CID 134879516) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is diethyl 2-[(E)-3-[(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate.
| Compound Name | diethyl 2-[(E)-3-[(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 134879516 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | diethyl 2-[(E)-3-[(4-methylphenyl)sulfonimidoyl]prop-2-enyl]propanedioate |
| SMILES | [H]N=[S@@](=O)(/C=C/CC(C(=O)OCC)C(=O)OCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-4-22-16(19)15(17(20)23-5-2)7-6-12-24(18,21)14-10-8-13(3)9-11-14/h6,8-12,15,18H,4-5,7H2,1-3H3/b12-6+/t24-/m1/s1 |
| InChIKey | VHTFLTFMOPEYQG-LQVUNVMMSA-N |
| XLogP | 3.05 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|