C16H7F17S — CID 134879538
[(E)-1,1,1,2,5,6,6,6-octafluoro-2,4,5-tris(trifluoromethyl)hex-3-en-3-yl]sulfanylmethylbenzene (PubChem CID 134879538) has the molecular formula C16H7F17S and a molecular weight of 554.27 g/mol. Its IUPAC name is [(E)-1,1,1,2,5,6,6,6-octafluoro-2,4,5-tris(trifluoromethyl)hex-3-en-3-yl]sulfanylmethylbenzene.
| Compound Name | [(E)-1,1,1,2,5,6,6,6-octafluoro-2,4,5-tris(trifluoromethyl)hex-3-en-3-yl]sulfanylmethylbenzene |
|---|---|
| PubChem CID | 134879538 |
| Molecular Formula | C16H7F17S |
| Molecular Weight | 554.27 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | [(E)-1,1,1,2,5,6,6,6-octafluoro-2,4,5-tris(trifluoromethyl)hex-3-en-3-yl]sulfanylmethylbenzene |
| SMILES | FC(F)(F)/C(=C(/SCc1ccccc1)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H7F17S/c17-10(13(22,23)24,14(25,26)27)8(12(19,20)21)9(34-6-7-4-2-1-3-5-7)11(18,15(28,29)30)16(31,32)33/h1-5H,6H2/b9-8+ |
| InChIKey | OYNFDGUFMCKEAV-CMDGGOBGSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.27 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |