C38H44O6Si — CID 134879546
2-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]-1-trimethylsilylethanone (PubChem CID 134879546) has the molecular formula C38H44O6Si and a molecular weight of 624.85 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]-1-trimethylsilylethanone.
| Compound Name | 2-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]-1-trimethylsilylethanone |
|---|---|
| PubChem CID | 134879546 |
| Molecular Formula | C38H44O6Si |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | 2-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]-1-trimethylsilylethanone |
| SMILES | C[Si](C)(C)C(=O)C[C@@H]1O[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H44O6Si/c1-45(2,3)34(39)24-33-35(40-25-29-16-8-4-9-17-29)36(41-26-30-18-10-5-11-19-30)37(42-27-31-20-12-6-13-21-31)38(44-33)43-28-32-22-14-7-15-23-32/h4-23,33,35-38H,24-28H2,1-3H3/t33-,35-,36+,37-,38-/m0/s1 |
| InChIKey | OIMNFDNZIZGYDX-MQWCQDLSSA-N |
| XLogP | 7.52 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|