About [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate
[(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate (PubChem CID 134879555) has the molecular formula C10H23B2F8NS
and a molecular weight of 362.98 g/mol. Its IUPAC name is [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate.
Molecular Properties
| Compound Name | [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate |
| PubChem CID | 134879555 |
| Molecular Formula | C10H23B2F8NS |
| Molecular Weight | 362.98 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate |
| SMILES | CC[N+](/C=C/[S+](C)C)(CC)CC.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C10H23NS.2BF4/c1-6-11(7-2,8-3)9-10-12(4)5;2*2-1(3,4)5/h9-10H,6-8H2,1-5H3;;/q+2;2*-1/b10-9+;; |
| InChIKey | OTCBGFMNVSAGBL-TTWKNDKESA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.98 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate?
The IUPAC name of [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate (CID 134879555) is [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate.
What is the SMILES notation for [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate?
The canonical SMILES for [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate is CC[N+](/C=C/[S+](C)C)(CC)CC.F[B-](F)(F)F.F[B-](F)(F)F.
What is the InChIKey of [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate?
The InChIKey is OTCBGFMNVSAGBL-TTWKNDKESA-N. The full InChI is InChI=1S/C10H23NS.2BF4/c1-6-11(7-2,8-3)9-10-12(4)5;2*2-1(3,4)5/h9-10H,6-8H2,1-5H3;;/q+2;2*-1/b10-9+;;.
What are the key properties of [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate?
[(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate has a molecular weight of 362.98 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-dimethylsulfonioethenyl]-triethylazanium ditetrafluoroborate is sourced from PubChem (CID 134879555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).