C14H16F3N — CID 134879800
1-[(E)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperidine (PubChem CID 134879800) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-[(E)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperidine.
| Compound Name | 1-[(E)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperidine |
|---|---|
| PubChem CID | 134879800 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[(E)-3,3,3-trifluoro-1-phenylprop-1-en-2-yl]piperidine |
| SMILES | FC(F)(F)/C(=C\c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C14H16F3N/c15-14(16,17)13(18-9-5-2-6-10-18)11-12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2/b13-11+ |
| InChIKey | LYWILEMDKRTJFA-ACCUITESSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |