C18H22BN2- — CID 134880062
spiro[2,4-diaza-3-boranuidatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,9'-9-boranuidabicyclo[3.3.1]nonane] (PubChem CID 134880062) has the molecular formula C18H22BN2- and a molecular weight of 277.20 g/mol. Its IUPAC name is spiro[2,4-diaza-3-boranuidatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,9'-9-boranuidabicyclo[3.3.1]nonane].
| Compound Name | spiro[2,4-diaza-3-boranuidatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,9'-9-boranuidabicyclo[3.3.1]nonane] |
|---|---|
| PubChem CID | 134880062 |
| Molecular Formula | C18H22BN2- |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | spiro[2,4-diaza-3-boranuidatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,9'-9-boranuidabicyclo[3.3.1]nonane] |
| SMILES | c1cc2c3c(cccc3c1)N[B-]1(N2)C2CCCC1CCC2 |
| InChI | InChI=1S/C18H22BN2/c1-5-13-6-2-12-17-18(13)16(11-1)20-19(21-17)14-7-3-8-15(19)10-4-9-14/h1-2,5-6,11-12,14-15,20-21H,3-4,7-10H2/q-1 |
| InChIKey | JTPXVPNGYQXUNZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|