C28H58OSiSn — CID 134880189
tert-butyl-[(2E,6E)-2,6-dimethyl-8-tributylstannylocta-2,6-dienoxy]-dimethylsilane (PubChem CID 134880189) has the molecular formula C28H58OSiSn and a molecular weight of 557.57 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-2,6-dimethyl-8-tributylstannylocta-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-2,6-dimethyl-8-tributylstannylocta-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134880189 |
| Molecular Formula | C28H58OSiSn |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | tert-butyl-[(2E,6E)-2,6-dimethyl-8-tributylstannylocta-2,6-dienoxy]-dimethylsilane |
| SMILES | CCCC[Sn](C/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C16H31OSi.3C4H9.Sn/c1-9-14(2)11-10-12-15(3)13-17-18(7,8)16(4,5)6;3*1-3-4-2;/h9,12H,1,10-11,13H2,2-8H3;3*1,3-4H2,2H3;/b14-9+,15-12+;;;; |
| InChIKey | SSBHQYKQYFRRMQ-MTYROMNFSA-N |
| XLogP | 10.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|