C16H32O3Si2 — CID 134880236
[(1Z,3E)-1-ethoxy-3-trimethylsilyloxyocta-1,3,7-trienoxy]-trimethylsilane (PubChem CID 134880236) has the molecular formula C16H32O3Si2 and a molecular weight of 328.60 g/mol. Its IUPAC name is [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyocta-1,3,7-trienoxy]-trimethylsilane.
| Compound Name | [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyocta-1,3,7-trienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134880236 |
| Molecular Formula | C16H32O3Si2 |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyocta-1,3,7-trienoxy]-trimethylsilane |
| SMILES | C=CCC/C=C(\C=C(\OCC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H32O3Si2/c1-9-11-12-13-15(18-20(3,4)5)14-16(17-10-2)19-21(6,7)8/h9,13-14H,1,10-12H2,2-8H3/b15-13+,16-14- |
| InChIKey | PSTZUGLEOXTBMH-ZNOBWPMYSA-N |
| XLogP | 5.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|